C13H14BrN3O3 — CID 110703591
N-(4-bromo-3-methylphenyl)-2-(1-methyl-3,5-dioxopyrazolidin-4-yl)acetamide (PubChem CID 110703591) has the molecular formula C13H14BrN3O3 and a molecular weight of 340.18 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-2-(1-methyl-3,5-dioxopyrazolidin-4-yl)acetamide.
| Compound Name | N-(4-bromo-3-methylphenyl)-2-(1-methyl-3,5-dioxopyrazolidin-4-yl)acetamide |
|---|---|
| PubChem CID | 110703591 |
| Molecular Formula | C13H14BrN3O3 |
| Molecular Weight | 340.18 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-2-(1-methyl-3,5-dioxopyrazolidin-4-yl)acetamide |
| SMILES | Cc1cc(NC(=O)CC2C(=O)NN(C)C2=O)ccc1Br |
| InChI | InChI=1S/C13H14BrN3O3/c1-7-5-8(3-4-10(7)14)15-11(18)6-9-12(19)16-17(2)13(9)20/h3-5,9H,6H2,1-2H3,(H,15,18)(H,16,19) |
| InChIKey | FEUDNZLQVAYTDV-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.18 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|