C9H13N3O — CID 110705181
6-methyl-N-propylpyridazine-3-carboxamide (PubChem CID 110705181) has the molecular formula C9H13N3O and a molecular weight of 179.22 g/mol. Its IUPAC name is 6-methyl-N-propylpyridazine-3-carboxamide.
| Compound Name | 6-methyl-N-propylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 110705181 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 6-methyl-N-propylpyridazine-3-carboxamide |
| SMILES | CCCNC(=O)c1ccc(C)nn1 |
| InChI | InChI=1S/C9H13N3O/c1-3-6-10-9(13)8-5-4-7(2)11-12-8/h4-5H,3,6H2,1-2H3,(H,10,13) |
| InChIKey | DXZURVQSYQLNIV-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |