C13H15FN2O2 — CID 110708115
4-[2-(3-fluorophenyl)acetyl]-1-methylpiperazin-2-one (PubChem CID 110708115) has the molecular formula C13H15FN2O2 and a molecular weight of 250.27 g/mol. Its IUPAC name is 4-[2-(3-fluorophenyl)acetyl]-1-methylpiperazin-2-one.
| Compound Name | 4-[2-(3-fluorophenyl)acetyl]-1-methylpiperazin-2-one |
|---|---|
| PubChem CID | 110708115 |
| Molecular Formula | C13H15FN2O2 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 4-[2-(3-fluorophenyl)acetyl]-1-methylpiperazin-2-one |
| SMILES | CN1CCN(C(=O)Cc2cccc(F)c2)CC1=O |
| InChI | InChI=1S/C13H15FN2O2/c1-15-5-6-16(9-13(15)18)12(17)8-10-3-2-4-11(14)7-10/h2-4,7H,5-6,8-9H2,1H3 |
| InChIKey | RVQGGQGVMKXASS-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |