C19H17Cl2FN2O2 — CID 166358962
4-[2-(3,5-dichlorophenyl)acetyl]-1-[(3-fluorophenyl)methyl]piperazin-2-one (PubChem CID 166358962) has the molecular formula C19H17Cl2FN2O2 and a molecular weight of 395.26 g/mol. Its IUPAC name is 4-[2-(3,5-dichlorophenyl)acetyl]-1-[(3-fluorophenyl)methyl]piperazin-2-one.
| Compound Name | 4-[2-(3,5-dichlorophenyl)acetyl]-1-[(3-fluorophenyl)methyl]piperazin-2-one |
|---|---|
| PubChem CID | 166358962 |
| Molecular Formula | C19H17Cl2FN2O2 |
| Molecular Weight | 395.26 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 4-[2-(3,5-dichlorophenyl)acetyl]-1-[(3-fluorophenyl)methyl]piperazin-2-one |
| SMILES | O=C(Cc1cc(Cl)cc(Cl)c1)N1CCN(Cc2cccc(F)c2)C(=O)C1 |
| InChI | InChI=1S/C19H17Cl2FN2O2/c20-15-6-14(7-16(21)10-15)9-18(25)24-5-4-23(19(26)12-24)11-13-2-1-3-17(22)8-13/h1-3,6-8,10H,4-5,9,11-12H2 |
| InChIKey | YNAPLRQLIYJYQA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.26 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |