C15H21N3O3 — CID 110709153
methyl 4-oxo-4-[4-(pyridin-4-ylmethyl)piperazin-1-yl]butanoate (PubChem CID 110709153) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is methyl 4-oxo-4-[4-(pyridin-4-ylmethyl)piperazin-1-yl]butanoate.
| Compound Name | methyl 4-oxo-4-[4-(pyridin-4-ylmethyl)piperazin-1-yl]butanoate |
|---|---|
| PubChem CID | 110709153 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | methyl 4-oxo-4-[4-(pyridin-4-ylmethyl)piperazin-1-yl]butanoate |
| SMILES | COC(=O)CCC(=O)N1CCN(Cc2ccncc2)CC1 |
| InChI | InChI=1S/C15H21N3O3/c1-21-15(20)3-2-14(19)18-10-8-17(9-11-18)12-13-4-6-16-7-5-13/h4-7H,2-3,8-12H2,1H3 |
| InChIKey | JFDSZDSGHLKCKI-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |