C23H32N4O3S — CID 134015012
4-tert-butyl-N-[3-oxo-3-[4-(pyridin-4-ylmethyl)piperazin-1-yl]propyl]benzenesulfonamide (PubChem CID 134015012) has the molecular formula C23H32N4O3S and a molecular weight of 444.60 g/mol. Its IUPAC name is 4-tert-butyl-N-[3-oxo-3-[4-(pyridin-4-ylmethyl)piperazin-1-yl]propyl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[3-oxo-3-[4-(pyridin-4-ylmethyl)piperazin-1-yl]propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 134015012 |
| Molecular Formula | C23H32N4O3S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 4-tert-butyl-N-[3-oxo-3-[4-(pyridin-4-ylmethyl)piperazin-1-yl]propyl]benzenesulfonamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)NCCC(=O)N2CCN(Cc3ccncc3)CC2)cc1 |
| InChI | InChI=1S/C23H32N4O3S/c1-23(2,3)20-4-6-21(7-5-20)31(29,30)25-13-10-22(28)27-16-14-26(15-17-27)18-19-8-11-24-12-9-19/h4-9,11-12,25H,10,13-18H2,1-3H3 |
| InChIKey | MNBCVGIKUYBKBS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |