C9H13N3O2 — CID 11071
6-amino-3-methyl-1-(2-methylprop-2-enyl)pyrimidine-2,4-dione (PubChem CID 11071) has the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. Its IUPAC name is 6-amino-3-methyl-1-(2-methylprop-2-enyl)pyrimidine-2,4-dione.
| Compound Name | 6-amino-3-methyl-1-(2-methylprop-2-enyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11071 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 6-amino-3-methyl-1-(2-methylprop-2-enyl)pyrimidine-2,4-dione |
| SMILES | C=C(C)Cn1c(N)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C9H13N3O2/c1-6(2)5-12-7(10)4-8(13)11(3)9(12)14/h4H,1,5,10H2,2-3H3 |
| InChIKey | FXNYSZHYMGWWEZ-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 70.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|