C16H17N3O5 — CID 110710351
3-(1,3-dioxoisoindol-2-yl)-N-[(3-methyl-2-oxo-1,3-oxazolidin-5-yl)methyl]propanamide (PubChem CID 110710351) has the molecular formula C16H17N3O5 and a molecular weight of 331.33 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-N-[(3-methyl-2-oxo-1,3-oxazolidin-5-yl)methyl]propanamide.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-N-[(3-methyl-2-oxo-1,3-oxazolidin-5-yl)methyl]propanamide |
|---|---|
| PubChem CID | 110710351 |
| Molecular Formula | C16H17N3O5 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-N-[(3-methyl-2-oxo-1,3-oxazolidin-5-yl)methyl]propanamide |
| SMILES | CN1CC(CNC(=O)CCN2C(=O)c3ccccc3C2=O)OC1=O |
| InChI | InChI=1S/C16H17N3O5/c1-18-9-10(24-16(18)23)8-17-13(20)6-7-19-14(21)11-4-2-3-5-12(11)15(19)22/h2-5,10H,6-9H2,1H3,(H,17,20) |
| InChIKey | XGXLPKKGSTZHJC-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|