C15H17FN2O3 — CID 110710657
3-[1-(3-fluorobenzoyl)piperidin-4-yl]-1,3-oxazolidin-2-one (PubChem CID 110710657) has the molecular formula C15H17FN2O3 and a molecular weight of 292.31 g/mol. Its IUPAC name is 3-[1-(3-fluorobenzoyl)piperidin-4-yl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[1-(3-fluorobenzoyl)piperidin-4-yl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 110710657 |
| Molecular Formula | C15H17FN2O3 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 3-[1-(3-fluorobenzoyl)piperidin-4-yl]-1,3-oxazolidin-2-one |
| SMILES | O=C(c1cccc(F)c1)N1CCC(N2CCOC2=O)CC1 |
| InChI | InChI=1S/C15H17FN2O3/c16-12-3-1-2-11(10-12)14(19)17-6-4-13(5-7-17)18-8-9-21-15(18)20/h1-3,10,13H,4-9H2 |
| InChIKey | IAAPLFLHXMGDPY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |