C17H17FN2O2S — CID 110715217
1-cyclopropyl-4-(4-fluorophenyl)sulfonyl-2,3-dihydroquinoxaline (PubChem CID 110715217) has the molecular formula C17H17FN2O2S and a molecular weight of 332.40 g/mol. Its IUPAC name is 1-cyclopropyl-4-(4-fluorophenyl)sulfonyl-2,3-dihydroquinoxaline.
| Compound Name | 1-cyclopropyl-4-(4-fluorophenyl)sulfonyl-2,3-dihydroquinoxaline |
|---|---|
| PubChem CID | 110715217 |
| Molecular Formula | C17H17FN2O2S |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 1-cyclopropyl-4-(4-fluorophenyl)sulfonyl-2,3-dihydroquinoxaline |
| SMILES | O=S(=O)(c1ccc(F)cc1)N1CCN(C2CC2)c2ccccc21 |
| InChI | InChI=1S/C17H17FN2O2S/c18-13-5-9-15(10-6-13)23(21,22)20-12-11-19(14-7-8-14)16-3-1-2-4-17(16)20/h1-6,9-10,14H,7-8,11-12H2 |
| InChIKey | AIGQFKUZZXEXAV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |