C15H15FN2OS — CID 110716132
N-cyclopropyl-3-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]benzamide (PubChem CID 110716132) has the molecular formula C15H15FN2OS and a molecular weight of 290.36 g/mol. Its IUPAC name is N-cyclopropyl-3-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]benzamide.
| Compound Name | N-cyclopropyl-3-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 110716132 |
| Molecular Formula | C15H15FN2OS |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | N-cyclopropyl-3-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]benzamide |
| SMILES | O=C(c1cccc(F)c1)N(CCc1nccs1)C1CC1 |
| InChI | InChI=1S/C15H15FN2OS/c16-12-3-1-2-11(10-12)15(19)18(13-4-5-13)8-6-14-17-7-9-20-14/h1-3,7,9-10,13H,4-6,8H2 |
| InChIKey | OMMFYGDMICPBTQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |