C27H53ClN2O7 — CID 11071729
[6-[(2R,3S,4R,5R,6R)-5-(3,3-dimethylbutanoylamino)-3-hydroxy-2-(hydroxymethyl)-6-nonoxyoxan-4-yl]oxy-6-oxohexyl]azanium chloride (PubChem CID 11071729) has the molecular formula C27H53ClN2O7 and a molecular weight of 553.18 g/mol. Its IUPAC name is [6-[(2R,3S,4R,5R,6R)-5-(3,3-dimethylbutanoylamino)-3-hydroxy-2-(hydroxymethyl)-6-nonoxyoxan-4-yl]oxy-6-oxohexyl]azanium chloride.
| Compound Name | [6-[(2R,3S,4R,5R,6R)-5-(3,3-dimethylbutanoylamino)-3-hydroxy-2-(hydroxymethyl)-6-nonoxyoxan-4-yl]oxy-6-oxohexyl]azanium chloride |
|---|---|
| PubChem CID | 11071729 |
| Molecular Formula | C27H53ClN2O7 |
| Molecular Weight | 553.18 g/mol |
| Exact Mass | 552.35 |
| IUPAC Name | [6-[(2R,3S,4R,5R,6R)-5-(3,3-dimethylbutanoylamino)-3-hydroxy-2-(hydroxymethyl)-6-nonoxyoxan-4-yl]oxy-6-oxohexyl]azanium chloride |
| SMILES | CCCCCCCCCO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](OC(=O)CCCCC[NH3+])[C@H]1NC(=O)CC(C)(C)C.[Cl-] |
| InChI | InChI=1S/C27H52N2O7.ClH/c1-5-6-7-8-9-10-14-17-34-26-23(29-21(31)18-27(2,3)4)25(24(33)20(19-30)35-26)36-22(32)15-12-11-13-16-28;/h20,23-26,30,33H,5-19,28H2,1-4H3,(H,29,31);1H/t20-,23-,24-,25-,26-;/m1./s1 |
| InChIKey | SMHLUYJPIPVWIQ-XSGSBIFTSA-N |
| XLogP | -0.53 |
| TPSA | 141.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.18 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|