C12H11Cl2N3O2S — CID 110718005
N-[(2-amino-1,3-thiazol-4-yl)methyl]-2-(2,4-dichlorophenoxy)acetamide (PubChem CID 110718005) has the molecular formula C12H11Cl2N3O2S and a molecular weight of 332.21 g/mol. Its IUPAC name is N-[(2-amino-1,3-thiazol-4-yl)methyl]-2-(2,4-dichlorophenoxy)acetamide.
| Compound Name | N-[(2-amino-1,3-thiazol-4-yl)methyl]-2-(2,4-dichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 110718005 |
| Molecular Formula | C12H11Cl2N3O2S |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 330.99 |
| IUPAC Name | N-[(2-amino-1,3-thiazol-4-yl)methyl]-2-(2,4-dichlorophenoxy)acetamide |
| SMILES | Nc1nc(CNC(=O)COc2ccc(Cl)cc2Cl)cs1 |
| InChI | InChI=1S/C12H11Cl2N3O2S/c13-7-1-2-10(9(14)3-7)19-5-11(18)16-4-8-6-20-12(15)17-8/h1-3,6H,4-5H2,(H2,15,17)(H,16,18) |
| InChIKey | HPXREGIXGZLSLB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |