C14H20N2O6S — CID 110719319
3,4-dimethoxy-N-[3-(2-oxo-1,3-oxazolidin-3-yl)propyl]benzenesulfonamide (PubChem CID 110719319) has the molecular formula C14H20N2O6S and a molecular weight of 344.39 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[3-(2-oxo-1,3-oxazolidin-3-yl)propyl]benzenesulfonamide.
| Compound Name | 3,4-dimethoxy-N-[3-(2-oxo-1,3-oxazolidin-3-yl)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110719319 |
| Molecular Formula | C14H20N2O6S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 3,4-dimethoxy-N-[3-(2-oxo-1,3-oxazolidin-3-yl)propyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCCN2CCOC2=O)cc1OC |
| InChI | InChI=1S/C14H20N2O6S/c1-20-12-5-4-11(10-13(12)21-2)23(18,19)15-6-3-7-16-8-9-22-14(16)17/h4-5,10,15H,3,6-9H2,1-2H3 |
| InChIKey | AHIWBNVOYZWVGY-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|