About CID 11072062
CID 11072062 (PubChem CID 11072062) has the molecular formula C11H12OSe2
and a molecular weight of 318.14 g/mol.
Molecular Properties
| Compound Name | CID 11072062 |
| PubChem CID | 11072062 |
| Molecular Formula | C11H12OSe2 |
| Molecular Weight | 318.14 g/mol |
| Exact Mass | 319.92 |
| IUPAC Name | — |
| SMILES | CCO/C=C(/[Se])C([Se])c1ccccc1 |
| InChI | InChI=1S/C11H12OSe2/c1-2-12-8-10(13)11(14)9-6-4-3-5-7-9/h3-8,11H,2H2,1H3/b10-8+ |
| InChIKey | QQJREQOENBGUTH-CSKARUKUSA-N |
| XLogP | 1.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.14 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 11072062 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11072062?
The IUPAC name of CID 11072062 (CID 11072062) is not available.
What is the SMILES notation for CID 11072062?
The canonical SMILES for CID 11072062 is CCO/C=C(/[Se])C([Se])c1ccccc1.
What is the InChIKey of CID 11072062?
The InChIKey is QQJREQOENBGUTH-CSKARUKUSA-N. The full InChI is InChI=1S/C11H12OSe2/c1-2-12-8-10(13)11(14)9-6-4-3-5-7-9/h3-8,11H,2H2,1H3/b10-8+.
What are the key properties of CID 11072062?
CID 11072062 has a molecular weight of 318.14 g/mol, XLogP of 1.94, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11072062 is sourced from PubChem (CID 11072062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).