C15H22N2O4S — CID 110721025
benzyl N-[3-(1,1-dioxothiazinan-2-yl)propyl]carbamate (PubChem CID 110721025) has the molecular formula C15H22N2O4S and a molecular weight of 326.42 g/mol. Its IUPAC name is benzyl N-[3-(1,1-dioxothiazinan-2-yl)propyl]carbamate.
| Compound Name | benzyl N-[3-(1,1-dioxothiazinan-2-yl)propyl]carbamate |
|---|---|
| PubChem CID | 110721025 |
| Molecular Formula | C15H22N2O4S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | benzyl N-[3-(1,1-dioxothiazinan-2-yl)propyl]carbamate |
| SMILES | O=C(NCCCN1CCCCS1(=O)=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H22N2O4S/c18-15(21-13-14-7-2-1-3-8-14)16-9-6-11-17-10-4-5-12-22(17,19)20/h1-3,7-8H,4-6,9-13H2,(H,16,18) |
| InChIKey | OIOSLKYIJWOWIE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|