C28H35BrN6O5 — CID 11072179
tert-butyl N-[(11S,14R)-5-bromo-11-methyl-10,13-dioxo-4-(pyrrolidin-1-yldiazenyl)-2-oxa-9,12-diazatricyclo[14.2.2.13,7]henicosa-1(18),3,5,7(21),16,19-hexaen-14-yl]carbamate (PubChem CID 11072179) has the molecular formula C28H35BrN6O5 and a molecular weight of 615.53 g/mol. Its IUPAC name is tert-butyl N-[(11S,14R)-5-bromo-11-methyl-10,13-dioxo-4-(pyrrolidin-1-yldiazenyl)-2-oxa-9,12-diazatricyclo[14.2.2.13,7]henicosa-1(18),3,5,7(21),16,19-hexaen-14-yl]carbamate.
| Compound Name | tert-butyl N-[(11S,14R)-5-bromo-11-methyl-10,13-dioxo-4-(pyrrolidin-1-yldiazenyl)-2-oxa-9,12-diazatricyclo[14.2.2.13,7]henicosa-1(18),3,5,7(21),16,19-hexaen-14-yl]carbamate |
|---|---|
| PubChem CID | 11072179 |
| Molecular Formula | C28H35BrN6O5 |
| Molecular Weight | 615.53 g/mol |
| Exact Mass | 614.19 |
| IUPAC Name | tert-butyl N-[(11S,14R)-5-bromo-11-methyl-10,13-dioxo-4-(pyrrolidin-1-yldiazenyl)-2-oxa-9,12-diazatricyclo[14.2.2.13,7]henicosa-1(18),3,5,7(21),16,19-hexaen-14-yl]carbamate |
| SMILES | C[C@@H]1NC(=O)[C@H](NC(=O)OC(C)(C)C)Cc2ccc(cc2)Oc2cc(cc(Br)c2/N=N/N2CCCC2)CNC1=O |
| InChI | InChI=1S/C28H35BrN6O5/c1-17-25(36)30-16-19-13-21(29)24(33-34-35-11-5-6-12-35)23(15-19)39-20-9-7-18(8-10-20)14-22(26(37)31-17)32-27(38)40-28(2,3)4/h7-10,13,15,17,22H,5-6,11-12,14,16H2,1-4H3,(H,30,36)(H,31,37)(H,32,38)/b34-33+/t17-,22+/m0/s1 |
| InChIKey | BTHGVZJFTCVAKW-KFRSYYIGSA-N |
| XLogP | 4.91 |
| TPSA | 133.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.53 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|