C31H48O9SSi — CID 11072229
(1R)-2-(benzenesulfonyl)-1-[(4R,5S)-5-[(R)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4,4,4-trimethoxybutan-1-ol (PubChem CID 11072229) has the molecular formula C31H48O9SSi and a molecular weight of 624.87 g/mol. Its IUPAC name is (1R)-2-(benzenesulfonyl)-1-[(4R,5S)-5-[(R)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4,4,4-trimethoxybutan-1-ol.
| Compound Name | (1R)-2-(benzenesulfonyl)-1-[(4R,5S)-5-[(R)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4,4,4-trimethoxybutan-1-ol |
|---|---|
| PubChem CID | 11072229 |
| Molecular Formula | C31H48O9SSi |
| Molecular Weight | 624.87 g/mol |
| Exact Mass | 624.28 |
| IUPAC Name | (1R)-2-(benzenesulfonyl)-1-[(4R,5S)-5-[(R)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4,4,4-trimethoxybutan-1-ol |
| SMILES | COC(CC([C@H](O)[C@H]1OC(C)(C)O[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)c1ccccc1)S(=O)(=O)c1ccccc1)(OC)OC |
| InChI | InChI=1S/C31H48O9SSi/c1-29(2,3)42(9,10)40-26(22-17-13-11-14-18-22)28-27(38-30(4,5)39-28)25(32)24(21-31(35-6,36-7)37-8)41(33,34)23-19-15-12-16-20-23/h11-20,24-28,32H,21H2,1-10H3/t24?,25-,26+,27+,28+/m0/s1 |
| InChIKey | URGWAEWTPWCCPT-OOTAPUKVSA-N |
| XLogP | 5.46 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.87 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|