C35H60O10SSi — CID 11072543
[(6S)-2-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(1R,2R,4R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(2-methoxyethoxymethoxy)cyclopentyl]heptyl] acetate (PubChem CID 11072543) has the molecular formula C35H60O10SSi and a molecular weight of 701.01 g/mol. Its IUPAC name is [(6S)-2-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(1R,2R,4R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(2-methoxyethoxymethoxy)cyclopentyl]heptyl] acetate.
| Compound Name | [(6S)-2-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(1R,2R,4R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(2-methoxyethoxymethoxy)cyclopentyl]heptyl] acetate |
|---|---|
| PubChem CID | 11072543 |
| Molecular Formula | C35H60O10SSi |
| Molecular Weight | 701.01 g/mol |
| Exact Mass | 700.37 |
| IUPAC Name | [(6S)-2-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(1R,2R,4R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(2-methoxyethoxymethoxy)cyclopentyl]heptyl] acetate |
| SMILES | COCCOCO[C@@H]1C[C@@H]([C@H]2COC(C)(C)O2)[C@H](C(OC(C)=O)C(CCC[C@H](C)O[Si](C)(C)C(C)(C)C)S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C35H60O10SSi/c1-25(45-47(9,10)34(3,4)5)15-14-18-32(46(37,38)28-16-12-11-13-17-28)33(43-26(2)36)30-22-27(41-24-40-20-19-39-8)21-29(30)31-23-42-35(6,7)44-31/h11-13,16-17,25,27,29-33H,14-15,18-24H2,1-10H3/t25-,27+,29+,30+,31+,32?,33?/m0/s1 |
| InChIKey | HMCMUPBWVKHCIZ-GOLMTSEBSA-N |
| XLogP | 6.52 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.01 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|