C17H17N3O2S — CID 110726562
N-[4-(1H-imidazol-2-yl)phenyl]-3,4-dimethylbenzenesulfonamide (PubChem CID 110726562) has the molecular formula C17H17N3O2S and a molecular weight of 327.41 g/mol. Its IUPAC name is N-[4-(1H-imidazol-2-yl)phenyl]-3,4-dimethylbenzenesulfonamide.
| Compound Name | N-[4-(1H-imidazol-2-yl)phenyl]-3,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 110726562 |
| Molecular Formula | C17H17N3O2S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | N-[4-(1H-imidazol-2-yl)phenyl]-3,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(-c3ncc[nH]3)cc2)cc1C |
| InChI | InChI=1S/C17H17N3O2S/c1-12-3-8-16(11-13(12)2)23(21,22)20-15-6-4-14(5-7-15)17-18-9-10-19-17/h3-11,20H,1-2H3,(H,18,19) |
| InChIKey | HTZCBOXLXHWQCM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |