About pent-3-ene-2-thiol
pent-3-ene-2-thiol (PubChem CID 11072706) has the molecular formula C5H10S
and a molecular weight of 102.20 g/mol. Its IUPAC name is pent-3-ene-2-thiol.
Molecular Properties
| Compound Name | pent-3-ene-2-thiol |
| PubChem CID | 11072706 |
| Molecular Formula | C5H10S |
| Molecular Weight | 102.20 g/mol |
| Exact Mass | 102.05 |
| IUPAC Name | pent-3-ene-2-thiol |
| SMILES | CC=CC(C)S |
| InChI | InChI=1S/C5H10S/c1-3-4-5(2)6/h3-6H,1-2H3 |
| InChIKey | QXMQRUBDOSIQBI-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.20 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze pent-3-ene-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pent-3-ene-2-thiol?
The IUPAC name of pent-3-ene-2-thiol (CID 11072706) is pent-3-ene-2-thiol.
What is the SMILES notation for pent-3-ene-2-thiol?
The canonical SMILES for pent-3-ene-2-thiol is CC=CC(C)S.
What is the InChIKey of pent-3-ene-2-thiol?
The InChIKey is QXMQRUBDOSIQBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10S/c1-3-4-5(2)6/h3-6H,1-2H3.
What are the key properties of pent-3-ene-2-thiol?
pent-3-ene-2-thiol has a molecular weight of 102.20 g/mol, XLogP of 1.88, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pent-3-ene-2-thiol is sourced from PubChem (CID 11072706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).