C14H22I2 — CID 159367477
(2E,6E)-4,5-bis[(E)-prop-1-enyl]octa-2,6-diene;molecular iodine (PubChem CID 159367477) has the molecular formula C14H22I2 and a molecular weight of 444.14 g/mol. Its IUPAC name is (2E,6E)-4,5-bis[(E)-prop-1-enyl]octa-2,6-diene;molecular iodine.
| Compound Name | (2E,6E)-4,5-bis[(E)-prop-1-enyl]octa-2,6-diene;molecular iodine |
|---|---|
| PubChem CID | 159367477 |
| Molecular Formula | C14H22I2 |
| Molecular Weight | 444.14 g/mol |
| Exact Mass | 443.98 |
| IUPAC Name | (2E,6E)-4,5-bis[(E)-prop-1-enyl]octa-2,6-diene;molecular iodine |
| SMILES | C/C=C/C(/C=C/C)C(/C=C/C)/C=C/C.II |
| InChI | InChI=1S/C14H22.I2/c1-5-9-13(10-6-2)14(11-7-3)12-8-4;1-2/h5-14H,1-4H3;/b9-5+,10-6+,11-7+,12-8+; |
| InChIKey | LJHUPPWRGTVGAT-HPDMOCHCSA-N |
| XLogP | 6.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.14 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|