C30H14Co4O12 — CID 11072822
carbon monoxide;cobalt;[(3S,4S)-4-phenylhexa-1,5-diyn-3-yl]benzene (PubChem CID 11072822) has the molecular formula C30H14Co4O12 and a molecular weight of 802.16 g/mol. Its IUPAC name is carbon monoxide;cobalt;[(3S,4S)-4-phenylhexa-1,5-diyn-3-yl]benzene.
| Compound Name | carbon monoxide;cobalt;[(3S,4S)-4-phenylhexa-1,5-diyn-3-yl]benzene |
|---|---|
| PubChem CID | 11072822 |
| Molecular Formula | C30H14Co4O12 |
| Molecular Weight | 802.16 g/mol |
| Exact Mass | 801.78 |
| IUPAC Name | carbon monoxide;cobalt;[(3S,4S)-4-phenylhexa-1,5-diyn-3-yl]benzene |
| SMILES | C#C[C@@H](c1ccccc1)[C@@H](C#C)c1ccccc1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[Co].[Co].[Co].[Co] |
| InChI | InChI=1S/C18H14.12CO.4Co/c1-3-17(15-11-7-5-8-12-15)18(4-2)16-13-9-6-10-14-16;12*1-2;;;;/h1-2,5-14,17-18H;;;;;;;;;;;;;;;;/t17-,18-;;;;;;;;;;;;;;;;/m0................/s1 |
| InChIKey | JCLAMVFVURTNGT-NUJLHSCOSA-N |
| XLogP | 3.36 |
| TPSA | 238.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.16 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|