C14H14N2O3S2 — CID 110729074
5-ethyl-N-(2-methyl-1,3-benzoxazol-6-yl)thiophene-2-sulfonamide (PubChem CID 110729074) has the molecular formula C14H14N2O3S2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 5-ethyl-N-(2-methyl-1,3-benzoxazol-6-yl)thiophene-2-sulfonamide.
| Compound Name | 5-ethyl-N-(2-methyl-1,3-benzoxazol-6-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110729074 |
| Molecular Formula | C14H14N2O3S2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 5-ethyl-N-(2-methyl-1,3-benzoxazol-6-yl)thiophene-2-sulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)Nc2ccc3nc(C)oc3c2)s1 |
| InChI | InChI=1S/C14H14N2O3S2/c1-3-11-5-7-14(20-11)21(17,18)16-10-4-6-12-13(8-10)19-9(2)15-12/h4-8,16H,3H2,1-2H3 |
| InChIKey | PKLDOOMVWSUWIM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |