C13H13FN2O3 — CID 110729773
N-(6-fluoro-3-oxo-4H-1,4-benzoxazin-8-yl)cyclobutanecarboxamide (PubChem CID 110729773) has the molecular formula C13H13FN2O3 and a molecular weight of 264.26 g/mol. Its IUPAC name is N-(6-fluoro-3-oxo-4H-1,4-benzoxazin-8-yl)cyclobutanecarboxamide.
| Compound Name | N-(6-fluoro-3-oxo-4H-1,4-benzoxazin-8-yl)cyclobutanecarboxamide |
|---|---|
| PubChem CID | 110729773 |
| Molecular Formula | C13H13FN2O3 |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | N-(6-fluoro-3-oxo-4H-1,4-benzoxazin-8-yl)cyclobutanecarboxamide |
| SMILES | O=C1COc2c(cc(F)cc2NC(=O)C2CCC2)N1 |
| InChI | InChI=1S/C13H13FN2O3/c14-8-4-9-12(19-6-11(17)15-9)10(5-8)16-13(18)7-2-1-3-7/h4-5,7H,1-3,6H2,(H,15,17)(H,16,18) |
| InChIKey | BPMLDWHRZZFZJY-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |