C15H13FN2O3S — CID 110729770
N-(6-fluoro-3-oxo-4H-1,4-benzoxazin-8-yl)-3-thiophen-2-ylpropanamide (PubChem CID 110729770) has the molecular formula C15H13FN2O3S and a molecular weight of 320.35 g/mol. Its IUPAC name is N-(6-fluoro-3-oxo-4H-1,4-benzoxazin-8-yl)-3-thiophen-2-ylpropanamide.
| Compound Name | N-(6-fluoro-3-oxo-4H-1,4-benzoxazin-8-yl)-3-thiophen-2-ylpropanamide |
|---|---|
| PubChem CID | 110729770 |
| Molecular Formula | C15H13FN2O3S |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | N-(6-fluoro-3-oxo-4H-1,4-benzoxazin-8-yl)-3-thiophen-2-ylpropanamide |
| SMILES | O=C(CCc1cccs1)Nc1cc(F)cc2c1OCC(=O)N2 |
| InChI | InChI=1S/C15H13FN2O3S/c16-9-6-11(15-12(7-9)18-14(20)8-21-15)17-13(19)4-3-10-2-1-5-22-10/h1-2,5-7H,3-4,8H2,(H,17,19)(H,18,20) |
| InChIKey | LYZOESAUCKNORB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |