C16H23N3O2 — CID 110730655
5-[[4-(cyclopentanecarbonyl)piperazin-1-yl]methyl]-1H-pyridin-2-one (PubChem CID 110730655) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 5-[[4-(cyclopentanecarbonyl)piperazin-1-yl]methyl]-1H-pyridin-2-one.
| Compound Name | 5-[[4-(cyclopentanecarbonyl)piperazin-1-yl]methyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 110730655 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 5-[[4-(cyclopentanecarbonyl)piperazin-1-yl]methyl]-1H-pyridin-2-one |
| SMILES | O=C(C1CCCC1)N1CCN(Cc2ccc(=O)[nH]c2)CC1 |
| InChI | InChI=1S/C16H23N3O2/c20-15-6-5-13(11-17-15)12-18-7-9-19(10-8-18)16(21)14-3-1-2-4-14/h5-6,11,14H,1-4,7-10,12H2,(H,17,20) |
| InChIKey | HXPTXMDBQZSXRG-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |