C18H25IN2O — CID 23969373
cyclopentyl-[4-[(3-iodophenyl)methyl]-1,4-diazepan-1-yl]methanone (PubChem CID 23969373) has the molecular formula C18H25IN2O and a molecular weight of 412.32 g/mol. Its IUPAC name is cyclopentyl-[4-[(3-iodophenyl)methyl]-1,4-diazepan-1-yl]methanone.
| Compound Name | cyclopentyl-[4-[(3-iodophenyl)methyl]-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 23969373 |
| Molecular Formula | C18H25IN2O |
| Molecular Weight | 412.32 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | cyclopentyl-[4-[(3-iodophenyl)methyl]-1,4-diazepan-1-yl]methanone |
| SMILES | O=C(C1CCCC1)N1CCCN(Cc2cccc(I)c2)CC1 |
| InChI | InChI=1S/C18H25IN2O/c19-17-8-3-5-15(13-17)14-20-9-4-10-21(12-11-20)18(22)16-6-1-2-7-16/h3,5,8,13,16H,1-2,4,6-7,9-12,14H2 |
| InChIKey | VQFGNINWLKOCPE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.32 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|