C18H21IN2OS — CID 23937651
1-[4-[(3-iodophenyl)methyl]-1,4-diazepan-1-yl]-2-thiophen-2-ylethanone (PubChem CID 23937651) has the molecular formula C18H21IN2OS and a molecular weight of 440.35 g/mol. Its IUPAC name is 1-[4-[(3-iodophenyl)methyl]-1,4-diazepan-1-yl]-2-thiophen-2-ylethanone.
| Compound Name | 1-[4-[(3-iodophenyl)methyl]-1,4-diazepan-1-yl]-2-thiophen-2-ylethanone |
|---|---|
| PubChem CID | 23937651 |
| Molecular Formula | C18H21IN2OS |
| Molecular Weight | 440.35 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | 1-[4-[(3-iodophenyl)methyl]-1,4-diazepan-1-yl]-2-thiophen-2-ylethanone |
| SMILES | O=C(Cc1cccs1)N1CCCN(Cc2cccc(I)c2)CC1 |
| InChI | InChI=1S/C18H21IN2OS/c19-16-5-1-4-15(12-16)14-20-7-3-8-21(10-9-20)18(22)13-17-6-2-11-23-17/h1-2,4-6,11-12H,3,7-10,13-14H2 |
| InChIKey | XMXWSHCWJUPOSC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.35 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|