C13H11F3N2O2 — CID 110730995
N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2,3,4-trifluorobenzamide (PubChem CID 110730995) has the molecular formula C13H11F3N2O2 and a molecular weight of 284.24 g/mol. Its IUPAC name is N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2,3,4-trifluorobenzamide.
| Compound Name | N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2,3,4-trifluorobenzamide |
|---|---|
| PubChem CID | 110730995 |
| Molecular Formula | C13H11F3N2O2 |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2,3,4-trifluorobenzamide |
| SMILES | Cc1noc(C)c1CNC(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H11F3N2O2/c1-6-9(7(2)20-18-6)5-17-13(19)8-3-4-10(14)12(16)11(8)15/h3-4H,5H2,1-2H3,(H,17,19) |
| InChIKey | ZZIAGAPYWPMZPP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|