C10H13NO2S — CID 110740009
1-(1,3-oxazolidin-3-yl)-3-thiophen-2-ylpropan-1-one (PubChem CID 110740009) has the molecular formula C10H13NO2S and a molecular weight of 211.29 g/mol. Its IUPAC name is 1-(1,3-oxazolidin-3-yl)-3-thiophen-2-ylpropan-1-one.
| Compound Name | 1-(1,3-oxazolidin-3-yl)-3-thiophen-2-ylpropan-1-one |
|---|---|
| PubChem CID | 110740009 |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | 1-(1,3-oxazolidin-3-yl)-3-thiophen-2-ylpropan-1-one |
| SMILES | O=C(CCc1cccs1)N1CCOC1 |
| InChI | InChI=1S/C10H13NO2S/c12-10(11-5-6-13-8-11)4-3-9-2-1-7-14-9/h1-2,7H,3-6,8H2 |
| InChIKey | PYYKSRBRDNFOSQ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |