C17H19NO3S — CID 110740382
2-phenyl-3-(2-phenylethylsulfonyl)-1,3-oxazolidine (PubChem CID 110740382) has the molecular formula C17H19NO3S and a molecular weight of 317.41 g/mol. Its IUPAC name is 2-phenyl-3-(2-phenylethylsulfonyl)-1,3-oxazolidine.
| Compound Name | 2-phenyl-3-(2-phenylethylsulfonyl)-1,3-oxazolidine |
|---|---|
| PubChem CID | 110740382 |
| Molecular Formula | C17H19NO3S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 2-phenyl-3-(2-phenylethylsulfonyl)-1,3-oxazolidine |
| SMILES | O=S(=O)(CCc1ccccc1)N1CCOC1c1ccccc1 |
| InChI | InChI=1S/C17H19NO3S/c19-22(20,14-11-15-7-3-1-4-8-15)18-12-13-21-17(18)16-9-5-2-6-10-16/h1-10,17H,11-14H2 |
| InChIKey | HNDBFVJTOPJCBF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |