C16H22N4O2S — CID 110741454
N-phenyl-2-[4-(1,3-thiazolidine-4-carbonyl)piperazin-1-yl]acetamide (PubChem CID 110741454) has the molecular formula C16H22N4O2S and a molecular weight of 334.44 g/mol. Its IUPAC name is N-phenyl-2-[4-(1,3-thiazolidine-4-carbonyl)piperazin-1-yl]acetamide.
| Compound Name | N-phenyl-2-[4-(1,3-thiazolidine-4-carbonyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 110741454 |
| Molecular Formula | C16H22N4O2S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | N-phenyl-2-[4-(1,3-thiazolidine-4-carbonyl)piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(C(=O)C2CSCN2)CC1)Nc1ccccc1 |
| InChI | InChI=1S/C16H22N4O2S/c21-15(18-13-4-2-1-3-5-13)10-19-6-8-20(9-7-19)16(22)14-11-23-12-17-14/h1-5,14,17H,6-12H2,(H,18,21) |
| InChIKey | QYWRCOFELHILRO-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |