About 3-[4-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]piperazine-1-carbonyl]-1H-pyridazin-6-one
3-[4-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]piperazine-1-carbonyl]-1H-pyridazin-6-one (PubChem CID 110742086) has the molecular formula C13H16N6O3
and a molecular weight of 304.31 g/mol. Its IUPAC name is 3-[4-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]piperazine-1-carbonyl]-1H-pyridazin-6-one.
Molecular Properties
| Compound Name | 3-[4-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]piperazine-1-carbonyl]-1H-pyridazin-6-one |
| PubChem CID | 110742086 |
| Molecular Formula | C13H16N6O3 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 3-[4-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]piperazine-1-carbonyl]-1H-pyridazin-6-one |
| SMILES | Cc1nnc(CN2CCN(C(=O)c3ccc(=O)[nH]n3)CC2)o1 |
| InChI | InChI=1S/C13H16N6O3/c1-9-14-17-12(22-9)8-18-4-6-19(7-5-18)13(21)10-2-3-11(20)16-15-10/h2-3H,4-8H2,1H3,(H,16,20) |
| InChIKey | UEZSFZWEERZGRW-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 108.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[4-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]piperazine-1-carbonyl]-1H-pyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]piperazine-1-carbonyl]-1H-pyridazin-6-one?
The IUPAC name of 3-[4-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]piperazine-1-carbonyl]-1H-pyridazin-6-one (CID 110742086) is 3-[4-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]piperazine-1-carbonyl]-1H-pyridazin-6-one.
What is the SMILES notation for 3-[4-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]piperazine-1-carbonyl]-1H-pyridazin-6-one?
The canonical SMILES for 3-[4-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]piperazine-1-carbonyl]-1H-pyridazin-6-one is Cc1nnc(CN2CCN(C(=O)c3ccc(=O)[nH]n3)CC2)o1.
What is the InChIKey of 3-[4-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]piperazine-1-carbonyl]-1H-pyridazin-6-one?
The InChIKey is UEZSFZWEERZGRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N6O3/c1-9-14-17-12(22-9)8-18-4-6-19(7-5-18)13(21)10-2-3-11(20)16-15-10/h2-3H,4-8H2,1H3,(H,16,20).
What are the key properties of 3-[4-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]piperazine-1-carbonyl]-1H-pyridazin-6-one?
3-[4-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]piperazine-1-carbonyl]-1H-pyridazin-6-one has a molecular weight of 304.31 g/mol, XLogP of -0.58, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]piperazine-1-carbonyl]-1H-pyridazin-6-one is sourced from PubChem (CID 110742086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).