C12H17N3O2 — CID 5227998
3-(3,5-dimethylpiperidine-1-carbonyl)-1H-pyridazin-6-one (PubChem CID 5227998) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 3-(3,5-dimethylpiperidine-1-carbonyl)-1H-pyridazin-6-one.
| Compound Name | 3-(3,5-dimethylpiperidine-1-carbonyl)-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 5227998 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 3-(3,5-dimethylpiperidine-1-carbonyl)-1H-pyridazin-6-one |
| SMILES | CC1CC(C)CN(C(=O)c2ccc(=O)[nH]n2)C1 |
| InChI | InChI=1S/C12H17N3O2/c1-8-5-9(2)7-15(6-8)12(17)10-3-4-11(16)14-13-10/h3-4,8-9H,5-7H2,1-2H3,(H,14,16) |
| InChIKey | ZZORWWHLOVFTGU-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |