C11H15N3O2 — CID 103709631
3-(3,4-dimethylpyrrolidine-1-carbonyl)-1H-pyridazin-6-one (PubChem CID 103709631) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is 3-(3,4-dimethylpyrrolidine-1-carbonyl)-1H-pyridazin-6-one.
| Compound Name | 3-(3,4-dimethylpyrrolidine-1-carbonyl)-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 103709631 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 3-(3,4-dimethylpyrrolidine-1-carbonyl)-1H-pyridazin-6-one |
| SMILES | CC1CN(C(=O)c2ccc(=O)[nH]n2)CC1C |
| InChI | InChI=1S/C11H15N3O2/c1-7-5-14(6-8(7)2)11(16)9-3-4-10(15)13-12-9/h3-4,7-8H,5-6H2,1-2H3,(H,13,15) |
| InChIKey | RZHOLZYODZQEFU-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |