C11H13N3O3 — CID 102979094
3-(3-methyl-4-oxopiperidine-1-carbonyl)-1H-pyridazin-6-one (PubChem CID 102979094) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is 3-(3-methyl-4-oxopiperidine-1-carbonyl)-1H-pyridazin-6-one.
| Compound Name | 3-(3-methyl-4-oxopiperidine-1-carbonyl)-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 102979094 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 3-(3-methyl-4-oxopiperidine-1-carbonyl)-1H-pyridazin-6-one |
| SMILES | CC1CN(C(=O)c2ccc(=O)[nH]n2)CCC1=O |
| InChI | InChI=1S/C11H13N3O3/c1-7-6-14(5-4-9(7)15)11(17)8-2-3-10(16)13-12-8/h2-3,7H,4-6H2,1H3,(H,13,16) |
| InChIKey | WXVCFFLTCYIOBS-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |