About N-[2-(1-acetyl-2,3-dihydroindol-3-yl)ethyl]pyrazine-2-carboxamide
N-[2-(1-acetyl-2,3-dihydroindol-3-yl)ethyl]pyrazine-2-carboxamide (PubChem CID 110744887) has the molecular formula C17H18N4O2
and a molecular weight of 310.36 g/mol. Its IUPAC name is N-[2-(1-acetyl-2,3-dihydroindol-3-yl)ethyl]pyrazine-2-carboxamide.
Molecular Properties
| Compound Name | N-[2-(1-acetyl-2,3-dihydroindol-3-yl)ethyl]pyrazine-2-carboxamide |
| PubChem CID | 110744887 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | N-[2-(1-acetyl-2,3-dihydroindol-3-yl)ethyl]pyrazine-2-carboxamide |
| SMILES | CC(=O)N1CC(CCNC(=O)c2cnccn2)c2ccccc21 |
| InChI | InChI=1S/C17H18N4O2/c1-12(22)21-11-13(14-4-2-3-5-16(14)21)6-7-20-17(23)15-10-18-8-9-19-15/h2-5,8-10,13H,6-7,11H2,1H3,(H,20,23) |
| InChIKey | HAMUPNLBACGBDE-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-(1-acetyl-2,3-dihydroindol-3-yl)ethyl]pyrazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1-acetyl-2,3-dihydroindol-3-yl)ethyl]pyrazine-2-carboxamide?
The IUPAC name of N-[2-(1-acetyl-2,3-dihydroindol-3-yl)ethyl]pyrazine-2-carboxamide (CID 110744887) is N-[2-(1-acetyl-2,3-dihydroindol-3-yl)ethyl]pyrazine-2-carboxamide.
What is the SMILES notation for N-[2-(1-acetyl-2,3-dihydroindol-3-yl)ethyl]pyrazine-2-carboxamide?
The canonical SMILES for N-[2-(1-acetyl-2,3-dihydroindol-3-yl)ethyl]pyrazine-2-carboxamide is CC(=O)N1CC(CCNC(=O)c2cnccn2)c2ccccc21.
What is the InChIKey of N-[2-(1-acetyl-2,3-dihydroindol-3-yl)ethyl]pyrazine-2-carboxamide?
The InChIKey is HAMUPNLBACGBDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N4O2/c1-12(22)21-11-13(14-4-2-3-5-16(14)21)6-7-20-17(23)15-10-18-8-9-19-15/h2-5,8-10,13H,6-7,11H2,1H3,(H,20,23).
What are the key properties of N-[2-(1-acetyl-2,3-dihydroindol-3-yl)ethyl]pyrazine-2-carboxamide?
N-[2-(1-acetyl-2,3-dihydroindol-3-yl)ethyl]pyrazine-2-carboxamide has a molecular weight of 310.36 g/mol, XLogP of 1.75, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1-acetyl-2,3-dihydroindol-3-yl)ethyl]pyrazine-2-carboxamide is sourced from PubChem (CID 110744887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).