C12H11NO3 — CID 11074822
(1R,2S,4S,7R)-7-phenyl-3,8-dioxa-6-azatricyclo[4.3.0.02,4]nonan-5-one (PubChem CID 11074822) has the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. Its IUPAC name is (1R,2S,4S,7R)-7-phenyl-3,8-dioxa-6-azatricyclo[4.3.0.02,4]nonan-5-one.
| Compound Name | (1R,2S,4S,7R)-7-phenyl-3,8-dioxa-6-azatricyclo[4.3.0.02,4]nonan-5-one |
|---|---|
| PubChem CID | 11074822 |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | (1R,2S,4S,7R)-7-phenyl-3,8-dioxa-6-azatricyclo[4.3.0.02,4]nonan-5-one |
| SMILES | O=C1[C@H]2O[C@H]2[C@H]2CO[C@H](c3ccccc3)N12 |
| InChI | InChI=1S/C12H11NO3/c14-11-10-9(16-10)8-6-15-12(13(8)11)7-4-2-1-3-5-7/h1-5,8-10,12H,6H2/t8-,9+,10+,12-/m1/s1 |
| InChIKey | PYASDOHMJWBBLK-FYLLDIAZSA-N |
| XLogP | 0.69 |
| TPSA | 42.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|