C11H17ClN2O2 — CID 110748928
1-[(5-chlorofuran-2-yl)methyl]-3-(2,2-dimethylpropyl)urea (PubChem CID 110748928) has the molecular formula C11H17ClN2O2 and a molecular weight of 244.72 g/mol. Its IUPAC name is 1-[(5-chlorofuran-2-yl)methyl]-3-(2,2-dimethylpropyl)urea.
| Compound Name | 1-[(5-chlorofuran-2-yl)methyl]-3-(2,2-dimethylpropyl)urea |
|---|---|
| PubChem CID | 110748928 |
| Molecular Formula | C11H17ClN2O2 |
| Molecular Weight | 244.72 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 1-[(5-chlorofuran-2-yl)methyl]-3-(2,2-dimethylpropyl)urea |
| SMILES | CC(C)(C)CNC(=O)NCc1ccc(Cl)o1 |
| InChI | InChI=1S/C11H17ClN2O2/c1-11(2,3)7-14-10(15)13-6-8-4-5-9(12)16-8/h4-5H,6-7H2,1-3H3,(H2,13,14,15) |
| InChIKey | YWAGXJBBZRHTIL-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.72 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |