C12H16N4O — CID 110749166
1-(2-methylimidazo[1,2-a]pyridin-6-yl)-3-propylurea (PubChem CID 110749166) has the molecular formula C12H16N4O and a molecular weight of 232.29 g/mol. Its IUPAC name is 1-(2-methylimidazo[1,2-a]pyridin-6-yl)-3-propylurea.
| Compound Name | 1-(2-methylimidazo[1,2-a]pyridin-6-yl)-3-propylurea |
|---|---|
| PubChem CID | 110749166 |
| Molecular Formula | C12H16N4O |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 1-(2-methylimidazo[1,2-a]pyridin-6-yl)-3-propylurea |
| SMILES | CCCNC(=O)Nc1ccc2nc(C)cn2c1 |
| InChI | InChI=1S/C12H16N4O/c1-3-6-13-12(17)15-10-4-5-11-14-9(2)7-16(11)8-10/h4-5,7-8H,3,6H2,1-2H3,(H2,13,15,17) |
| InChIKey | RPWHZFPGDZOSJG-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 58.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |