C16H27N3O2 — CID 110750203
1-acetyl-N-(1-cyclopropylpiperidin-4-yl)piperidine-4-carboxamide (PubChem CID 110750203) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is 1-acetyl-N-(1-cyclopropylpiperidin-4-yl)piperidine-4-carboxamide.
| Compound Name | 1-acetyl-N-(1-cyclopropylpiperidin-4-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 110750203 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 1-acetyl-N-(1-cyclopropylpiperidin-4-yl)piperidine-4-carboxamide |
| SMILES | CC(=O)N1CCC(C(=O)NC2CCN(C3CC3)CC2)CC1 |
| InChI | InChI=1S/C16H27N3O2/c1-12(20)18-8-4-13(5-9-18)16(21)17-14-6-10-19(11-7-14)15-2-3-15/h13-15H,2-11H2,1H3,(H,17,21) |
| InChIKey | DFQOIHLEZGSESN-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |