C17H30N2O2 — CID 130233575
1-acetyl-N-(4-ethyl-4-methylcyclohexyl)piperidine-4-carboxamide (PubChem CID 130233575) has the molecular formula C17H30N2O2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 1-acetyl-N-(4-ethyl-4-methylcyclohexyl)piperidine-4-carboxamide.
| Compound Name | 1-acetyl-N-(4-ethyl-4-methylcyclohexyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 130233575 |
| Molecular Formula | C17H30N2O2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | 1-acetyl-N-(4-ethyl-4-methylcyclohexyl)piperidine-4-carboxamide |
| SMILES | CCC1(C)CCC(NC(=O)C2CCN(C(C)=O)CC2)CC1 |
| InChI | InChI=1S/C17H30N2O2/c1-4-17(3)9-5-15(6-10-17)18-16(21)14-7-11-19(12-8-14)13(2)20/h14-15H,4-12H2,1-3H3,(H,18,21) |
| InChIKey | WZIZBHPFFKADRE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |