C10H15NO5 — CID 11075185
(3aR,4R,5S,5aS,7S,9aS)-4,5,7-trihydroxy-3a,4,5,5a,6,7,8,9a-octahydro-1H-furo[3,2-e]indolizin-2-one (PubChem CID 11075185) has the molecular formula C10H15NO5 and a molecular weight of 229.23 g/mol. Its IUPAC name is (3aR,4R,5S,5aS,7S,9aS)-4,5,7-trihydroxy-3a,4,5,5a,6,7,8,9a-octahydro-1H-furo[3,2-e]indolizin-2-one.
| Compound Name | (3aR,4R,5S,5aS,7S,9aS)-4,5,7-trihydroxy-3a,4,5,5a,6,7,8,9a-octahydro-1H-furo[3,2-e]indolizin-2-one |
|---|---|
| PubChem CID | 11075185 |
| Molecular Formula | C10H15NO5 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | (3aR,4R,5S,5aS,7S,9aS)-4,5,7-trihydroxy-3a,4,5,5a,6,7,8,9a-octahydro-1H-furo[3,2-e]indolizin-2-one |
| SMILES | O=C1C[C@H]2[C@@H](O1)[C@H](O)[C@@H](O)[C@@H]1C[C@H](O)CN12 |
| InChI | InChI=1S/C10H15NO5/c12-4-1-5-8(14)9(15)10-6(11(5)3-4)2-7(13)16-10/h4-6,8-10,12,14-15H,1-3H2/t4-,5-,6-,8-,9+,10+/m0/s1 |
| InChIKey | GUXCRZFLLAMLGK-HXROFGBISA-N |
| XLogP | -2.16 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |