C17H17NO3 — CID 110752792
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-N,2-dimethylbenzamide (PubChem CID 110752792) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-N,2-dimethylbenzamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-N,2-dimethylbenzamide |
|---|---|
| PubChem CID | 110752792 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-N,2-dimethylbenzamide |
| SMILES | Cc1ccccc1C(=O)N(C)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C17H17NO3/c1-12-5-3-4-6-14(12)17(19)18(2)13-7-8-15-16(11-13)21-10-9-20-15/h3-8,11H,9-10H2,1-2H3 |
| InChIKey | DMWAAAVAGHPQMI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |