C11H12N2O4 — CID 115191645
N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-N'-methyloxamide (PubChem CID 115191645) has the molecular formula C11H12N2O4 and a molecular weight of 236.23 g/mol. Its IUPAC name is N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-N'-methyloxamide.
| Compound Name | N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-N'-methyloxamide |
|---|---|
| PubChem CID | 115191645 |
| Molecular Formula | C11H12N2O4 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-N'-methyloxamide |
| SMILES | CN(C(=O)C(N)=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C11H12N2O4/c1-13(11(15)10(12)14)7-2-3-8-9(6-7)17-5-4-16-8/h2-3,6H,4-5H2,1H3,(H2,12,14) |
| InChIKey | GZXAJUYSDGHGOZ-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|