C10H4F5N — CID 11075309
5,7-difluoro-2-(trifluoromethyl)quinoline (PubChem CID 11075309) has the molecular formula C10H4F5N and a molecular weight of 233.14 g/mol. Its IUPAC name is 5,7-difluoro-2-(trifluoromethyl)quinoline.
| Compound Name | 5,7-difluoro-2-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 11075309 |
| Molecular Formula | C10H4F5N |
| Molecular Weight | 233.14 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | 5,7-difluoro-2-(trifluoromethyl)quinoline |
| SMILES | Fc1cc(F)c2ccc(C(F)(F)F)nc2c1 |
| InChI | InChI=1S/C10H4F5N/c11-5-3-7(12)6-1-2-9(10(13,14)15)16-8(6)4-5/h1-4H |
| InChIKey | MANDGIZZFBIKPQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.14 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |