C10H6F3NO2 — CID 135735543
2-(trifluoromethyl)quinoline-6,7-diol (PubChem CID 135735543) has the molecular formula C10H6F3NO2 and a molecular weight of 229.16 g/mol. Its IUPAC name is 2-(trifluoromethyl)quinoline-6,7-diol.
| Compound Name | 2-(trifluoromethyl)quinoline-6,7-diol |
|---|---|
| PubChem CID | 135735543 |
| Molecular Formula | C10H6F3NO2 |
| Molecular Weight | 229.16 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | 2-(trifluoromethyl)quinoline-6,7-diol |
| SMILES | Oc1cc2ccc(C(F)(F)F)nc2cc1O |
| InChI | InChI=1S/C10H6F3NO2/c11-10(12,13)9-2-1-5-3-7(15)8(16)4-6(5)14-9/h1-4,15-16H |
| InChIKey | MXPMFQIMGFDHNJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.16 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|