About 2-(trifluoromethyl)quinoline-6,7-diol
2-(trifluoromethyl)quinoline-6,7-diol (PubChem CID 135735543) has the molecular formula C10H6F3NO2
and a molecular weight of 229.16 g/mol. Its IUPAC name is 2-(trifluoromethyl)quinoline-6,7-diol.
Molecular Properties
| Compound Name | 2-(trifluoromethyl)quinoline-6,7-diol |
| PubChem CID | 135735543 |
| Molecular Formula | C10H6F3NO2 |
| Molecular Weight | 229.16 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | 2-(trifluoromethyl)quinoline-6,7-diol |
| SMILES | Oc1cc2ccc(C(F)(F)F)nc2cc1O |
| InChI | InChI=1S/C10H6F3NO2/c11-10(12,13)9-2-1-5-3-7(15)8(16)4-6(5)14-9/h1-4,15-16H |
| InChIKey | MXPMFQIMGFDHNJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.16 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-(trifluoromethyl)quinoline-6,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(trifluoromethyl)quinoline-6,7-diol?
The IUPAC name of 2-(trifluoromethyl)quinoline-6,7-diol (CID 135735543) is 2-(trifluoromethyl)quinoline-6,7-diol.
What is the SMILES notation for 2-(trifluoromethyl)quinoline-6,7-diol?
The canonical SMILES for 2-(trifluoromethyl)quinoline-6,7-diol is Oc1cc2ccc(C(F)(F)F)nc2cc1O.
What is the InChIKey of 2-(trifluoromethyl)quinoline-6,7-diol?
The InChIKey is MXPMFQIMGFDHNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6F3NO2/c11-10(12,13)9-2-1-5-3-7(15)8(16)4-6(5)14-9/h1-4,15-16H.
What are the key properties of 2-(trifluoromethyl)quinoline-6,7-diol?
2-(trifluoromethyl)quinoline-6,7-diol has a molecular weight of 229.16 g/mol, XLogP of 2.66, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(trifluoromethyl)quinoline-6,7-diol is sourced from PubChem (CID 135735543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).