C9H12ClNO2 — CID 11075480
(4R,7R,11S)-7-chloro-5-oxa-1-azatricyclo[5.3.1.04,11]undecan-6-one (PubChem CID 11075480) has the molecular formula C9H12ClNO2 and a molecular weight of 201.65 g/mol. Its IUPAC name is (4R,7R,11S)-7-chloro-5-oxa-1-azatricyclo[5.3.1.04,11]undecan-6-one.
| Compound Name | (4R,7R,11S)-7-chloro-5-oxa-1-azatricyclo[5.3.1.04,11]undecan-6-one |
|---|---|
| PubChem CID | 11075480 |
| Molecular Formula | C9H12ClNO2 |
| Molecular Weight | 201.65 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | (4R,7R,11S)-7-chloro-5-oxa-1-azatricyclo[5.3.1.04,11]undecan-6-one |
| SMILES | O=C1O[C@@H]2CCN3CCC[C@@]1(Cl)[C@H]23 |
| InChI | InChI=1S/C9H12ClNO2/c10-9-3-1-4-11-5-2-6(7(9)11)13-8(9)12/h6-7H,1-5H2/t6-,7+,9-/m1/s1 |
| InChIKey | JZSRBUZNYPIRCT-BKPPORCPSA-N |
| XLogP | 0.76 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.65 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|