C16H28N2 — CID 11075824
N-tert-butyl-1-[2-[(2E,4E)-hexa-2,4-dienyl]piperidin-1-yl]methanimine (PubChem CID 11075824) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is N-tert-butyl-1-[2-[(2E,4E)-hexa-2,4-dienyl]piperidin-1-yl]methanimine.
| Compound Name | N-tert-butyl-1-[2-[(2E,4E)-hexa-2,4-dienyl]piperidin-1-yl]methanimine |
|---|---|
| PubChem CID | 11075824 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | N-tert-butyl-1-[2-[(2E,4E)-hexa-2,4-dienyl]piperidin-1-yl]methanimine |
| SMILES | C/C=C/C=C/CC1CCCCN1/C=N/C(C)(C)C |
| InChI | InChI=1S/C16H28N2/c1-5-6-7-8-11-15-12-9-10-13-18(15)14-17-16(2,3)4/h5-8,14-15H,9-13H2,1-4H3/b6-5+,8-7+,17-14+ |
| InChIKey | CTDVDCHNQSFRTO-MEYUELCESA-N |
| XLogP | 4.19 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|